C12H23N3O2S2 — CID 158731591
(2S)-2-amino-3-(1H-imidazol-5-yl)propane-1-thiol;2-sulfanylhexanoic acid (PubChem CID 158731591) has the molecular formula C12H23N3O2S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-imidazol-5-yl)propane-1-thiol;2-sulfanylhexanoic acid.
| Compound Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propane-1-thiol;2-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 158731591 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propane-1-thiol;2-sulfanylhexanoic acid |
| SMILES | CCCCC(S)C(=O)O.N[C@H](CS)Cc1cnc[nH]1 |
| InChI | InChI=1S/C6H11N3S.C6H12O2S/c7-5(3-10)1-6-2-8-4-9-6;1-2-3-4-5(9)6(7)8/h2,4-5,10H,1,3,7H2,(H,8,9);5,9H,2-4H2,1H3,(H,7,8)/t5-;/m0./s1 |
| InChIKey | ILDVKCMVMQSWJJ-JEDNCBNOSA-N |
| XLogP | 1.77 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|