About zinc;tributylphosphane;diacetate
zinc;tributylphosphane;diacetate (PubChem CID 158741952) has the molecular formula C16H33O4PZn
and a molecular weight of 385.80 g/mol. Its IUPAC name is zinc;tributylphosphane;diacetate.
Molecular Properties
| Compound Name | zinc;tributylphosphane;diacetate |
| PubChem CID | 158741952 |
| Molecular Formula | C16H33O4PZn |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | zinc;tributylphosphane;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CCCCP(CCCC)CCCC.[Zn+2] |
| InChI | InChI=1S/C12H27P.2C2H4O2.Zn/c1-4-7-10-13(11-8-5-2)12-9-6-3;2*1-2(3)4;/h4-12H2,1-3H3;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | QCWOEUBNYHARGW-UHFFFAOYSA-L |
| XLogP | 2.38 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;tributylphosphane;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;tributylphosphane;diacetate?
The IUPAC name of zinc;tributylphosphane;diacetate (CID 158741952) is zinc;tributylphosphane;diacetate.
What is the SMILES notation for zinc;tributylphosphane;diacetate?
The canonical SMILES for zinc;tributylphosphane;diacetate is CC(=O)[O-].CC(=O)[O-].CCCCP(CCCC)CCCC.[Zn+2].
What is the InChIKey of zinc;tributylphosphane;diacetate?
The InChIKey is QCWOEUBNYHARGW-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H27P.2C2H4O2.Zn/c1-4-7-10-13(11-8-5-2)12-9-6-3;2*1-2(3)4;/h4-12H2,1-3H3;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of zinc;tributylphosphane;diacetate?
zinc;tributylphosphane;diacetate has a molecular weight of 385.80 g/mol, XLogP of 2.38, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;tributylphosphane;diacetate is sourced from PubChem (CID 158741952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).