C37H47Br2NO4 — CID 158759634
2-bromo-2-(4-tert-butylphenyl)acetic acid;2-bromo-2-(4-tert-butylphenyl)-N-[4-(cyclohexylmethoxy)phenyl]acetamide (PubChem CID 158759634) has the molecular formula C37H47Br2NO4 and a molecular weight of 729.59 g/mol. Its IUPAC name is 2-bromo-2-(4-tert-butylphenyl)acetic acid;2-bromo-2-(4-tert-butylphenyl)-N-[4-(cyclohexylmethoxy)phenyl]acetamide.
| Compound Name | 2-bromo-2-(4-tert-butylphenyl)acetic acid;2-bromo-2-(4-tert-butylphenyl)-N-[4-(cyclohexylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 158759634 |
| Molecular Formula | C37H47Br2NO4 |
| Molecular Weight | 729.59 g/mol |
| Exact Mass | 727.19 |
| IUPAC Name | 2-bromo-2-(4-tert-butylphenyl)acetic acid;2-bromo-2-(4-tert-butylphenyl)-N-[4-(cyclohexylmethoxy)phenyl]acetamide |
| SMILES | CC(C)(C)c1ccc(C(Br)C(=O)Nc2ccc(OCC3CCCCC3)cc2)cc1.CC(C)(C)c1ccc(C(Br)C(=O)O)cc1 |
| InChI | InChI=1S/C25H32BrNO2.C12H15BrO2/c1-25(2,3)20-11-9-19(10-12-20)23(26)24(28)27-21-13-15-22(16-14-21)29-17-18-7-5-4-6-8-18;1-12(2,3)9-6-4-8(5-7-9)10(13)11(14)15/h9-16,18,23H,4-8,17H2,1-3H3,(H,27,28);4-7,10H,1-3H3,(H,14,15) |
| InChIKey | IOMQEMDKHXEDED-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.59 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|