C34H42N2O4S2 — CID 143734929
4-[1-(4-tert-butylphenyl)-2-[4-(cyclohexylmethoxy)anilino]-2-oxoethyl]sulfanyl-N-(2-hydroxysulfanylethyl)benzamide (PubChem CID 143734929) has the molecular formula C34H42N2O4S2 and a molecular weight of 606.85 g/mol. Its IUPAC name is 4-[1-(4-tert-butylphenyl)-2-[4-(cyclohexylmethoxy)anilino]-2-oxoethyl]sulfanyl-N-(2-hydroxysulfanylethyl)benzamide.
| Compound Name | 4-[1-(4-tert-butylphenyl)-2-[4-(cyclohexylmethoxy)anilino]-2-oxoethyl]sulfanyl-N-(2-hydroxysulfanylethyl)benzamide |
|---|---|
| PubChem CID | 143734929 |
| Molecular Formula | C34H42N2O4S2 |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 4-[1-(4-tert-butylphenyl)-2-[4-(cyclohexylmethoxy)anilino]-2-oxoethyl]sulfanyl-N-(2-hydroxysulfanylethyl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(Sc2ccc(C(=O)NCCSO)cc2)C(=O)Nc2ccc(OCC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C34H42N2O4S2/c1-34(2,3)27-13-9-25(10-14-27)31(42-30-19-11-26(12-20-30)32(37)35-21-22-41-39)33(38)36-28-15-17-29(18-16-28)40-23-24-7-5-4-6-8-24/h9-20,24,31,39H,4-8,21-23H2,1-3H3,(H,35,37)(H,36,38) |
| InChIKey | FLZKGPYURSVHQE-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|