C34H43NO6S — CID 87418018
2-[4-[2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethanesulfonic acid (PubChem CID 87418018) has the molecular formula C34H43NO6S and a molecular weight of 593.79 g/mol. Its IUPAC name is 2-[4-[2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethanesulfonic acid.
| Compound Name | 2-[4-[2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 87418018 |
| Molecular Formula | C34H43NO6S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 2-[4-[2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(OCCS(=O)(=O)O)cc2)C(=O)Nc2ccc(OCC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C34H43NO6S/c1-34(2,3)28-13-11-27(12-14-28)32(23-25-9-17-30(18-10-25)40-21-22-42(37,38)39)33(36)35-29-15-19-31(20-16-29)41-24-26-7-5-4-6-8-26/h9-20,26,32H,4-8,21-24H2,1-3H3,(H,35,36)(H,37,38,39) |
| InChIKey | IBRCAZVZCQPTDN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|