C36H45NO4S — CID 87418528
O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethyl] ethanethioate (PubChem CID 87418528) has the molecular formula C36H45NO4S and a molecular weight of 587.83 g/mol. Its IUPAC name is O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethyl] ethanethioate.
| Compound Name | O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethyl] ethanethioate |
|---|---|
| PubChem CID | 87418528 |
| Molecular Formula | C36H45NO4S |
| Molecular Weight | 587.83 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-[4-(cyclohexylmethoxy)anilino]-3-oxopropyl]phenoxy]ethyl] ethanethioate |
| SMILES | CC(=S)OCCOc1ccc(C[C@H](C(=O)Nc2ccc(OCC3CCCCC3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H45NO4S/c1-26(42)39-22-23-40-32-18-10-27(11-19-32)24-34(29-12-14-30(15-13-29)36(2,3)4)35(38)37-31-16-20-33(21-17-31)41-25-28-8-6-5-7-9-28/h10-21,28,34H,5-9,22-25H2,1-4H3,(H,37,38)/t34-/m0/s1 |
| InChIKey | OOGIPJCPLDROMX-UMSFTDKQSA-N |
| XLogP | 8.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.83 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|