C37H47NO4S — CID 87418167
O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-(4-cyclohexyl-N-methoxyanilino)-2-methyl-3-oxopropyl]phenoxy]ethyl] ethanethioate (PubChem CID 87418167) has the molecular formula C37H47NO4S and a molecular weight of 601.85 g/mol. Its IUPAC name is O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-(4-cyclohexyl-N-methoxyanilino)-2-methyl-3-oxopropyl]phenoxy]ethyl] ethanethioate.
| Compound Name | O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-(4-cyclohexyl-N-methoxyanilino)-2-methyl-3-oxopropyl]phenoxy]ethyl] ethanethioate |
|---|---|
| PubChem CID | 87418167 |
| Molecular Formula | C37H47NO4S |
| Molecular Weight | 601.85 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | O-[2-[4-[(2S)-2-(4-tert-butylphenyl)-3-(4-cyclohexyl-N-methoxyanilino)-2-methyl-3-oxopropyl]phenoxy]ethyl] ethanethioate |
| SMILES | CON(C(=O)[C@@](C)(Cc1ccc(OCCOC(C)=S)cc1)c1ccc(C(C)(C)C)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C37H47NO4S/c1-27(43)41-24-25-42-34-22-12-28(13-23-34)26-37(5,32-18-16-31(17-19-32)36(2,3)4)35(39)38(40-6)33-20-14-30(15-21-33)29-10-8-7-9-11-29/h12-23,29H,7-11,24-26H2,1-6H3/t37-/m0/s1 |
| InChIKey | LMIMWUJPLWUZQQ-QNGWXLTQSA-N |
| XLogP | 8.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.85 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|