About di(propan-2-yl)phosphane;propane
di(propan-2-yl)phosphane;propane (PubChem CID 158768506) has the molecular formula C9H23P
and a molecular weight of 162.26 g/mol. Its IUPAC name is di(propan-2-yl)phosphane;propane.
Molecular Properties
| Compound Name | di(propan-2-yl)phosphane;propane |
| PubChem CID | 158768506 |
| Molecular Formula | C9H23P |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.15 |
| IUPAC Name | di(propan-2-yl)phosphane;propane |
| SMILES | CC(C)PC(C)C.CCC |
| InChI | InChI=1S/C6H15P.C3H8/c1-5(2)7-6(3)4;1-3-2/h5-7H,1-4H3;3H2,1-2H3 |
| InChIKey | IPOJSUKRCSMMDI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze di(propan-2-yl)phosphane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)phosphane;propane?
The IUPAC name of di(propan-2-yl)phosphane;propane (CID 158768506) is di(propan-2-yl)phosphane;propane.
What is the SMILES notation for di(propan-2-yl)phosphane;propane?
The canonical SMILES for di(propan-2-yl)phosphane;propane is CC(C)PC(C)C.CCC.
What is the InChIKey of di(propan-2-yl)phosphane;propane?
The InChIKey is IPOJSUKRCSMMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P.C3H8/c1-5(2)7-6(3)4;1-3-2/h5-7H,1-4H3;3H2,1-2H3.
What are the key properties of di(propan-2-yl)phosphane;propane?
di(propan-2-yl)phosphane;propane has a molecular weight of 162.26 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)phosphane;propane is sourced from PubChem (CID 158768506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).