C25H51N3O6 — CID 158770809
2-amino-N-[5-[2-[2-[2-butoxyethyl-[2-(4-methylpentoxy)ethyl]amino]ethoxy]ethoxy]-2-oxopentyl]acetamide (PubChem CID 158770809) has the molecular formula C25H51N3O6 and a molecular weight of 489.70 g/mol. Its IUPAC name is 2-amino-N-[5-[2-[2-[2-butoxyethyl-[2-(4-methylpentoxy)ethyl]amino]ethoxy]ethoxy]-2-oxopentyl]acetamide.
| Compound Name | 2-amino-N-[5-[2-[2-[2-butoxyethyl-[2-(4-methylpentoxy)ethyl]amino]ethoxy]ethoxy]-2-oxopentyl]acetamide |
|---|---|
| PubChem CID | 158770809 |
| Molecular Formula | C25H51N3O6 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.38 |
| IUPAC Name | 2-amino-N-[5-[2-[2-[2-butoxyethyl-[2-(4-methylpentoxy)ethyl]amino]ethoxy]ethoxy]-2-oxopentyl]acetamide |
| SMILES | CCCCOCCN(CCOCCCC(C)C)CCOCCOCCCC(=O)CNC(=O)CN |
| InChI | InChI=1S/C25H51N3O6/c1-4-5-13-31-16-10-28(11-17-32-14-6-8-23(2)3)12-18-34-20-19-33-15-7-9-24(29)22-27-25(30)21-26/h23H,4-22,26H2,1-3H3,(H,27,30) |
| InChIKey | SJWPSTCKOVWXBX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|