C17H27NO4S — CID 158772157
tert-butyl formate;3-(4-methylphenyl)sulfonylpiperidine (PubChem CID 158772157) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is tert-butyl formate;3-(4-methylphenyl)sulfonylpiperidine.
| Compound Name | tert-butyl formate;3-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 158772157 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | tert-butyl formate;3-(4-methylphenyl)sulfonylpiperidine |
| SMILES | CC(C)(C)OC=O.Cc1ccc(S(=O)(=O)C2CCCNC2)cc1 |
| InChI | InChI=1S/C12H17NO2S.C5H10O2/c1-10-4-6-11(7-5-10)16(14,15)12-3-2-8-13-9-12;1-5(2,3)7-4-6/h4-7,12-13H,2-3,8-9H2,1H3;4H,1-3H3 |
| InChIKey | IPZTWFYZIZAUDJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|