C18H38O2Si2 — CID 15877500
1,5-bis[tert-butyl(dimethyl)silyl]-2-methylpentane-1,5-dione (PubChem CID 15877500) has the molecular formula C18H38O2Si2 and a molecular weight of 342.67 g/mol. Its IUPAC name is 1,5-bis[tert-butyl(dimethyl)silyl]-2-methylpentane-1,5-dione.
| Compound Name | 1,5-bis[tert-butyl(dimethyl)silyl]-2-methylpentane-1,5-dione |
|---|---|
| PubChem CID | 15877500 |
| Molecular Formula | C18H38O2Si2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1,5-bis[tert-butyl(dimethyl)silyl]-2-methylpentane-1,5-dione |
| SMILES | CC(CCC(=O)[Si](C)(C)C(C)(C)C)C(=O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O2Si2/c1-14(16(20)22(10,11)18(5,6)7)12-13-15(19)21(8,9)17(2,3)4/h14H,12-13H2,1-11H3 |
| InChIKey | PQBVNVCGIMQDRY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|