C12H26O2Si2 — CID 15877499
2-methyl-1,5-bis(trimethylsilyl)pentane-1,5-dione (PubChem CID 15877499) has the molecular formula C12H26O2Si2 and a molecular weight of 258.51 g/mol. Its IUPAC name is 2-methyl-1,5-bis(trimethylsilyl)pentane-1,5-dione.
| Compound Name | 2-methyl-1,5-bis(trimethylsilyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 15877499 |
| Molecular Formula | C12H26O2Si2 |
| Molecular Weight | 258.51 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-methyl-1,5-bis(trimethylsilyl)pentane-1,5-dione |
| SMILES | CC(CCC(=O)[Si](C)(C)C)C(=O)[Si](C)(C)C |
| InChI | InChI=1S/C12H26O2Si2/c1-10(12(14)16(5,6)7)8-9-11(13)15(2,3)4/h10H,8-9H2,1-7H3 |
| InChIKey | FJMXDWPIDNJUOC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|