C20H37N4O7PS — CID 158781982
[[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methylphosphonic acid (PubChem CID 158781982) has the molecular formula C20H37N4O7PS and a molecular weight of 508.58 g/mol. Its IUPAC name is [[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methylphosphonic acid.
| Compound Name | [[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 158781982 |
| Molecular Formula | C20H37N4O7PS |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | [[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methylphosphonic acid |
| SMILES | C[C@H](O)CN1CCN(Cc2ccc(S(=O)(=O)NCP(=O)(O)O)cc2)CCN(C[C@H](C)O)CC1 |
| InChI | InChI=1S/C20H37N4O7PS/c1-17(25)13-22-7-8-23(14-18(2)26)10-12-24(11-9-22)15-19-3-5-20(6-4-19)33(30,31)21-16-32(27,28)29/h3-6,17-18,21,25-26H,7-16H2,1-2H3,(H2,27,28,29)/t17-,18-/m0/s1 |
| InChIKey | OTFXOWDAMXUFFR-ROUUACIJSA-N |
| XLogP | -0.72 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|