C20H36N4O7PS- — CID 163849627
[[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methyl-hydroxyphosphinate (PubChem CID 163849627) has the molecular formula C20H36N4O7PS- and a molecular weight of 507.57 g/mol. Its IUPAC name is [[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methyl-hydroxyphosphinate.
| Compound Name | [[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 163849627 |
| Molecular Formula | C20H36N4O7PS- |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | [[4-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]phenyl]sulfonylamino]methyl-hydroxyphosphinate |
| SMILES | C[C@H](O)CN1CCN(Cc2ccc(S(=O)(=O)NCP(=O)([O-])O)cc2)CCN(C[C@H](C)O)CC1 |
| InChI | InChI=1S/C20H37N4O7PS/c1-17(25)13-22-7-8-23(14-18(2)26)10-12-24(11-9-22)15-19-3-5-20(6-4-19)33(30,31)21-16-32(27,28)29/h3-6,17-18,21,25-26H,7-16H2,1-2H3,(H2,27,28,29)/p-1/t17-,18-/m0/s1 |
| InChIKey | OTFXOWDAMXUFFR-ROUUACIJSA-M |
| XLogP | -1.35 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|