C19H32N3NaO5S — CID 171758915
sodium 2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonate (PubChem CID 171758915) has the molecular formula C19H32N3NaO5S and a molecular weight of 437.54 g/mol. Its IUPAC name is sodium 2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonate.
| Compound Name | sodium 2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 171758915 |
| Molecular Formula | C19H32N3NaO5S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | sodium 2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonate |
| SMILES | C[C@H](O)CN1CCN(Cc2ccccc2S(=O)(=O)[O-])CCN(C[C@H](C)O)CC1.[Na+] |
| InChI | InChI=1S/C19H33N3O5S.Na/c1-16(23)13-20-7-8-21(14-17(2)24)10-12-22(11-9-20)15-18-5-3-4-6-19(18)28(25,26)27;/h3-6,16-17,23-24H,7-15H2,1-2H3,(H,25,26,27);/q;+1/p-1/t16-,17-;/m0./s1 |
| InChIKey | FYVANCUTDCWZHY-QJHJCNPRSA-M |
| XLogP | -3.22 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|