C19H33N3O5S — CID 165144516
2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonic acid (PubChem CID 165144516) has the molecular formula C19H33N3O5S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 165144516 |
| Molecular Formula | C19H33N3O5S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-[[4,7-bis[(2S)-2-hydroxypropyl]-1,4,7-triazonan-1-yl]methyl]benzenesulfonic acid |
| SMILES | C[C@H](O)CN1CCN(Cc2ccccc2S(=O)(=O)O)CCN(C[C@H](C)O)CC1 |
| InChI | InChI=1S/C19H33N3O5S/c1-16(23)13-20-7-8-21(14-17(2)24)10-12-22(11-9-20)15-18-5-3-4-6-19(18)28(25,26)27/h3-6,16-17,23-24H,7-15H2,1-2H3,(H,25,26,27)/t16-,17-/m0/s1 |
| InChIKey | MAFCMKNSLPCPFN-IRXDYDNUSA-N |
| XLogP | 0.11 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|