C23H30FeN3O3 — CID 171758884
iron(3+);2-[[4-[(2-oxidophenyl)methyl]-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]methyl]phenolate (PubChem CID 171758884) has the molecular formula C23H30FeN3O3 and a molecular weight of 452.36 g/mol. Its IUPAC name is iron(3+);2-[[4-[(2-oxidophenyl)methyl]-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]methyl]phenolate.
| Compound Name | iron(3+);2-[[4-[(2-oxidophenyl)methyl]-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]methyl]phenolate |
|---|---|
| PubChem CID | 171758884 |
| Molecular Formula | C23H30FeN3O3 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | iron(3+);2-[[4-[(2-oxidophenyl)methyl]-7-[(2S)-2-oxidopropyl]-1,4,7-triazonan-1-yl]methyl]phenolate |
| SMILES | C[C@H]([O-])CN1CCN(Cc2ccccc2[O-])CCN(Cc2ccccc2[O-])CC1.[Fe+3] |
| InChI | InChI=1S/C23H32N3O3.Fe/c1-19(27)16-24-10-12-25(17-20-6-2-4-8-22(20)28)14-15-26(13-11-24)18-21-7-3-5-9-23(21)29;/h2-9,19,28-29H,10-18H2,1H3;/q-1;+3/p-2/t19-;/m0./s1 |
| InChIKey | PCSMTQNUIVEFQG-FYZYNONXSA-L |
| XLogP | 0.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|