C13H18ClN5S — CID 158784856
N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-methylsulfanylpropanimidamide;methane (PubChem CID 158784856) has the molecular formula C13H18ClN5S and a molecular weight of 311.84 g/mol. Its IUPAC name is N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-methylsulfanylpropanimidamide;methane.
| Compound Name | N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-methylsulfanylpropanimidamide;methane |
|---|---|
| PubChem CID | 158784856 |
| Molecular Formula | C13H18ClN5S |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-methylsulfanylpropanimidamide;methane |
| SMILES | C.CSCC/C(N)=N\c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C12H14ClN5S.CH4/c1-19-6-4-11(14)16-10-8-18(17-12(10)13)9-3-2-5-15-7-9;/h2-3,5,7-8H,4,6H2,1H3,(H2,14,16);1H4 |
| InChIKey | IRNWJCVMJWPTMD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|