C11H12ClN5S — CID 123946612
N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-sulfanylpropanimidamide (PubChem CID 123946612) has the molecular formula C11H12ClN5S and a molecular weight of 281.77 g/mol. Its IUPAC name is N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-sulfanylpropanimidamide.
| Compound Name | N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-sulfanylpropanimidamide |
|---|---|
| PubChem CID | 123946612 |
| Molecular Formula | C11H12ClN5S |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N'-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-sulfanylpropanimidamide |
| SMILES | N/C(CCS)=N/c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C11H12ClN5S/c12-11-9(15-10(13)3-5-18)7-17(16-11)8-2-1-4-14-6-8/h1-2,4,6-7,18H,3,5H2,(H2,13,15) |
| InChIKey | ZAGSWTXKLWAYSM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|