C31H32Cl2N4O8 — CID 158787080
ethyl 2-chloro-5-(5,6-dimethyl-2,4-dioxo-1H-pyrimidin-3-yl)benzoate;ethyl 2-chloro-5-(3,4,5-trimethyl-2,6-dioxopyrimidin-1-yl)benzoate (PubChem CID 158787080) has the molecular formula C31H32Cl2N4O8 and a molecular weight of 659.52 g/mol. Its IUPAC name is ethyl 2-chloro-5-(5,6-dimethyl-2,4-dioxo-1H-pyrimidin-3-yl)benzoate;ethyl 2-chloro-5-(3,4,5-trimethyl-2,6-dioxopyrimidin-1-yl)benzoate.
| Compound Name | ethyl 2-chloro-5-(5,6-dimethyl-2,4-dioxo-1H-pyrimidin-3-yl)benzoate;ethyl 2-chloro-5-(3,4,5-trimethyl-2,6-dioxopyrimidin-1-yl)benzoate |
|---|---|
| PubChem CID | 158787080 |
| Molecular Formula | C31H32Cl2N4O8 |
| Molecular Weight | 659.52 g/mol |
| Exact Mass | 658.16 |
| IUPAC Name | ethyl 2-chloro-5-(5,6-dimethyl-2,4-dioxo-1H-pyrimidin-3-yl)benzoate;ethyl 2-chloro-5-(3,4,5-trimethyl-2,6-dioxopyrimidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc(-n2c(=O)[nH]c(C)c(C)c2=O)ccc1Cl.CCOC(=O)c1cc(-n2c(=O)c(C)c(C)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C16H17ClN2O4.C15H15ClN2O4/c1-5-23-15(21)12-8-11(6-7-13(12)17)19-14(20)9(2)10(3)18(4)16(19)22;1-4-22-14(20)11-7-10(5-6-12(11)16)18-13(19)8(2)9(3)17-15(18)21/h6-8H,5H2,1-4H3;5-7H,4H2,1-3H3,(H,17,21) |
| InChIKey | IRUYAGWQCBSNFR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |