C42H84N2O7 — CID 158793005
N-(dimethoxymethoxy)methanamine;(Z)-N-methoxy-N-methyloctadec-9-enamide;(Z)-octadec-9-enoic acid (PubChem CID 158793005) has the molecular formula C42H84N2O7 and a molecular weight of 729.14 g/mol. Its IUPAC name is N-(dimethoxymethoxy)methanamine;(Z)-N-methoxy-N-methyloctadec-9-enamide;(Z)-octadec-9-enoic acid.
| Compound Name | N-(dimethoxymethoxy)methanamine;(Z)-N-methoxy-N-methyloctadec-9-enamide;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 158793005 |
| Molecular Formula | C42H84N2O7 |
| Molecular Weight | 729.14 g/mol |
| Exact Mass | 728.63 |
| IUPAC Name | N-(dimethoxymethoxy)methanamine;(Z)-N-methoxy-N-methyloctadec-9-enamide;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(C)OC.CCCCCCCC/C=C\CCCCCCCC(=O)O.CNOC(OC)OC |
| InChI | InChI=1S/C20H39NO2.C18H34O2.C4H11NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21(2)23-3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-5-8-4(6-2)7-3/h11-12H,4-10,13-19H2,1-3H3;9-10H,2-8,11-17H2,1H3,(H,19,20);4-5H,1-3H3/b12-11-;10-9-; |
| InChIKey | ISMYFNOXEVRYTA-XKQXTMBUSA-N |
| XLogP | 11.87 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.14 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|