C22H31FO2S — CID 158793201
(8S,9R,10S,13S,14S,16R)-13-(ethylsulfanylmethyl)-9-fluoro-16-methoxy-10-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 158793201) has the molecular formula C22H31FO2S and a molecular weight of 378.55 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,16R)-13-(ethylsulfanylmethyl)-9-fluoro-16-methoxy-10-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13S,14S,16R)-13-(ethylsulfanylmethyl)-9-fluoro-16-methoxy-10-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 158793201 |
| Molecular Formula | C22H31FO2S |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (8S,9R,10S,13S,14S,16R)-13-(ethylsulfanylmethyl)-9-fluoro-16-methoxy-10-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCSC[C@]12CC[C@@]3(F)[C@@H](CCC4=CC(=O)C=C[C@@]43C)[C@@H]1C[C@@H](OC)C2 |
| InChI | InChI=1S/C22H31FO2S/c1-4-26-14-21-9-10-22(23)18(19(21)12-17(13-21)25-3)6-5-15-11-16(24)7-8-20(15,22)2/h7-8,11,17-19H,4-6,9-10,12-14H2,1-3H3/t17-,18+,19+,20+,21-,22-/m1/s1 |
| InChIKey | ISNQCOLOIQEQLO-HZQJRTDASA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |