C26H35FO3S2 — CID 154399413
[(8S,9R,10S,13S,14S)-17-ethylsulfanyl-9-fluoro-10-methyl-3-oxo-17-prop-2-enylsulfanyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-13-yl]methyl acetate (PubChem CID 154399413) has the molecular formula C26H35FO3S2 and a molecular weight of 478.70 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S)-17-ethylsulfanyl-9-fluoro-10-methyl-3-oxo-17-prop-2-enylsulfanyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-13-yl]methyl acetate.
| Compound Name | [(8S,9R,10S,13S,14S)-17-ethylsulfanyl-9-fluoro-10-methyl-3-oxo-17-prop-2-enylsulfanyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-13-yl]methyl acetate |
|---|---|
| PubChem CID | 154399413 |
| Molecular Formula | C26H35FO3S2 |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(8S,9R,10S,13S,14S)-17-ethylsulfanyl-9-fluoro-10-methyl-3-oxo-17-prop-2-enylsulfanyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-13-yl]methyl acetate |
| SMILES | C=CCSC1(SCC)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)CC[C@@]21COC(C)=O |
| InChI | InChI=1S/C26H35FO3S2/c1-5-15-32-26(31-6-2)12-10-21-22-8-7-19-16-20(29)9-11-23(19,4)25(22,27)14-13-24(21,26)17-30-18(3)28/h5,9,11,16,21-22H,1,6-8,10,12-15,17H2,2-4H3/t21-,22-,23-,24+,25+,26?/m0/s1 |
| InChIKey | HIJHDNPPQAAIHT-WLVOVTHJSA-N |
| XLogP | 6.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|