C25H30ClFO5S — CID 57165487
[(8S,9R,10S,13R,14S)-9-fluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl 4-(chloromethylsulfanyl)-3-hydroxy-4-oxobutanoate (PubChem CID 57165487) has the molecular formula C25H30ClFO5S and a molecular weight of 497.03 g/mol. Its IUPAC name is [(8S,9R,10S,13R,14S)-9-fluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl 4-(chloromethylsulfanyl)-3-hydroxy-4-oxobutanoate.
| Compound Name | [(8S,9R,10S,13R,14S)-9-fluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl 4-(chloromethylsulfanyl)-3-hydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 57165487 |
| Molecular Formula | C25H30ClFO5S |
| Molecular Weight | 497.03 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [(8S,9R,10S,13R,14S)-9-fluoro-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl 4-(chloromethylsulfanyl)-3-hydroxy-4-oxobutanoate |
| SMILES | C[C@]12CC[C@@]3(F)[C@@H](CCC4=CC(=O)C=C[C@@]43C)[C@@H]1CC(=COC(=O)CC(O)C(=O)SCCl)C2 |
| InChI | InChI=1S/C25H30ClFO5S/c1-23-7-8-25(27)18(4-3-16-10-17(28)5-6-24(16,25)2)19(23)9-15(12-23)13-32-21(30)11-20(29)22(31)33-14-26/h5-6,10,13,18-20,29H,3-4,7-9,11-12,14H2,1-2H3/t18-,19-,20?,23+,24-,25+/m0/s1 |
| InChIKey | NSUCOJHMMHXJNG-WSHFASGRSA-N |
| XLogP | 5.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.03 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|