C16H22N4O3S — CID 15879894
ethyl (E)-3-amino-3-[2-(2-methylpropanoyl)hydrazinyl]-2-(phenylcarbamothioyl)prop-2-enoate (PubChem CID 15879894) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is ethyl (E)-3-amino-3-[2-(2-methylpropanoyl)hydrazinyl]-2-(phenylcarbamothioyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-amino-3-[2-(2-methylpropanoyl)hydrazinyl]-2-(phenylcarbamothioyl)prop-2-enoate |
|---|---|
| PubChem CID | 15879894 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | ethyl (E)-3-amino-3-[2-(2-methylpropanoyl)hydrazinyl]-2-(phenylcarbamothioyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(C(=S)Nc1ccccc1)=C(/N)NNC(=O)C(C)C |
| InChI | InChI=1S/C16H22N4O3S/c1-4-23-16(22)12(13(17)19-20-14(21)10(2)3)15(24)18-11-8-6-5-7-9-11/h5-10,19H,4,17H2,1-3H3,(H,18,24)(H,20,21)/b13-12- |
| InChIKey | JXMHBLIYCARDJT-SEYXRHQNSA-N |
| XLogP | 1.44 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|