C14H21NO3S — CID 158799610
methyl 4-methyl-3-[2-oxo-3-(propylamino)butyl]thiophene-2-carboxylate (PubChem CID 158799610) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is methyl 4-methyl-3-[2-oxo-3-(propylamino)butyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[2-oxo-3-(propylamino)butyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 158799610 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 4-methyl-3-[2-oxo-3-(propylamino)butyl]thiophene-2-carboxylate |
| SMILES | CCCNC(C)C(=O)Cc1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C14H21NO3S/c1-5-6-15-10(3)12(16)7-11-9(2)8-19-13(11)14(17)18-4/h8,10,15H,5-7H2,1-4H3 |
| InChIKey | BUYZZQMZPNCXSL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |