C26H27N9O3S — CID 158799680
[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methanamine;12-(oxan-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 158799680) has the molecular formula C26H27N9O3S and a molecular weight of 545.63 g/mol. Its IUPAC name is [5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methanamine;12-(oxan-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | [5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methanamine;12-(oxan-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 158799680 |
| Molecular Formula | C26H27N9O3S |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | [5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methanamine;12-(oxan-4-yl)-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(CN)cnc32)cc1.c1cc2c(ncc3nnc(C4CCOCC4)n32)[nH]1 |
| InChI | InChI=1S/C14H14N4O2S.C12H13N5O/c1-10-2-4-12(5-3-10)21(19,20)18-7-6-13-14(18)16-9-11(8-15)17-13;1-4-13-11-9(1)17-10(7-14-11)15-16-12(17)8-2-5-18-6-3-8/h2-7,9H,8,15H2,1H3;1,4,7-8,13H,2-3,5-6H2 |
| InChIKey | ITHZGUMDXUKZRV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |