C24H32F3N3O — CID 158801167
4-[5-(2-cyclohexylethyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)butan-2-one (PubChem CID 158801167) has the molecular formula C24H32F3N3O and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-[5-(2-cyclohexylethyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)butan-2-one.
| Compound Name | 4-[5-(2-cyclohexylethyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)butan-2-one |
|---|---|
| PubChem CID | 158801167 |
| Molecular Formula | C24H32F3N3O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 4-[5-(2-cyclohexylethyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)butan-2-one |
| SMILES | Cc1ccc(CC(=O)CCc2nnc(CCC3CCCCC3)n2CC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C24H32F3N3O/c1-17-8-10-20(18(2)14-17)15-21(31)11-13-23-29-28-22(30(23)16-24(25,26)27)12-9-19-6-4-3-5-7-19/h8,10,14,19H,3-7,9,11-13,15-16H2,1-2H3 |
| InChIKey | ITMSVGHLMSJBAZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |