About butane;bis(3-methylpentane);7-methyltridecane
butane;bis(3-methylpentane);7-methyltridecane (PubChem CID 158827048) has the molecular formula C30H68
and a molecular weight of 428.87 g/mol. Its IUPAC name is butane;bis(3-methylpentane);7-methyltridecane.
Molecular Properties
| Compound Name | butane;bis(3-methylpentane);7-methyltridecane |
| PubChem CID | 158827048 |
| Molecular Formula | C30H68 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.53 |
| IUPAC Name | butane;bis(3-methylpentane);7-methyltridecane |
| SMILES | CCC(C)CC.CCC(C)CC.CCCC.CCCCCCC(C)CCCCCC |
| InChI | InChI=1S/C14H30.2C6H14.C4H10/c1-4-6-8-10-12-14(3)13-11-9-7-5-2;2*1-4-6(3)5-2;1-3-4-2/h14H,4-13H2,1-3H3;2*6H,4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | IWOVRDSETIMHFM-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;bis(3-methylpentane);7-methyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;bis(3-methylpentane);7-methyltridecane?
The IUPAC name of butane;bis(3-methylpentane);7-methyltridecane (CID 158827048) is butane;bis(3-methylpentane);7-methyltridecane.
What is the SMILES notation for butane;bis(3-methylpentane);7-methyltridecane?
The canonical SMILES for butane;bis(3-methylpentane);7-methyltridecane is CCC(C)CC.CCC(C)CC.CCCC.CCCCCCC(C)CCCCCC.
What is the InChIKey of butane;bis(3-methylpentane);7-methyltridecane?
The InChIKey is IWOVRDSETIMHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30.2C6H14.C4H10/c1-4-6-8-10-12-14(3)13-11-9-7-5-2;2*1-4-6(3)5-2;1-3-4-2/h14H,4-13H2,1-3H3;2*6H,4-5H2,1-3H3;3-4H2,1-2H3.
What are the key properties of butane;bis(3-methylpentane);7-methyltridecane?
butane;bis(3-methylpentane);7-methyltridecane has a molecular weight of 428.87 g/mol, XLogP of 12.25, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;bis(3-methylpentane);7-methyltridecane is sourced from PubChem (CID 158827048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).