carbamic acid;diaminophosphinic acid

CH8N3O4P — CID 158832791

IUPACcarbamic acid;diaminophosphinic acid
SMILESNC(=O)O.NP(N)(=O)O
InChIInChI=1S/CH3NO2.H5N2O2P/c2-1(3)4;1-5(2,3)4/h2H2,(H,3,4);(H5,1,2,3,4)
InChIKeyIXGJORZQCSUHBH-UHFFFAOYSA-N
MW157.07 g/mol
LogP-1.37
Rot. Bonds

About carbamic acid;diaminophosphinic acid

carbamic acid;diaminophosphinic acid (PubChem CID 158832791) has the molecular formula CH8N3O4P and a molecular weight of 157.07 g/mol. Its IUPAC name is carbamic acid;diaminophosphinic acid.

Molecular Properties

Compound Namecarbamic acid;diaminophosphinic acid
PubChem CID158832791
Molecular FormulaCH8N3O4P
Molecular Weight157.07 g/mol
Exact Mass157.03
IUPAC Namecarbamic acid;diaminophosphinic acid
SMILESNC(=O)O.NP(N)(=O)O
InChIInChI=1S/CH3NO2.H5N2O2P/c2-1(3)4;1-5(2,3)4/h2H2,(H,3,4);(H5,1,2,3,4)
InChIKeyIXGJORZQCSUHBH-UHFFFAOYSA-N
XLogP-1.37
TPSA152.66 Ų
H-Bond Donors5
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.07
LogP ≤ 5-1.37
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze carbamic acid;diaminophosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbamic acid;diaminophosphinic acid?
The IUPAC name of carbamic acid;diaminophosphinic acid (CID 158832791) is carbamic acid;diaminophosphinic acid.
What is the SMILES notation for carbamic acid;diaminophosphinic acid?
The canonical SMILES for carbamic acid;diaminophosphinic acid is NC(=O)O.NP(N)(=O)O.
What is the InChIKey of carbamic acid;diaminophosphinic acid?
The InChIKey is IXGJORZQCSUHBH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO2.H5N2O2P/c2-1(3)4;1-5(2,3)4/h2H2,(H,3,4);(H5,1,2,3,4).
What are the key properties of carbamic acid;diaminophosphinic acid?
carbamic acid;diaminophosphinic acid has a molecular weight of 157.07 g/mol, XLogP of -1.37, 0 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;diaminophosphinic acid is sourced from PubChem (CID 158832791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).