About carbamic acid;diaminophosphinic acid
carbamic acid;diaminophosphinic acid (PubChem CID 158832791) has the molecular formula CH8N3O4P
and a molecular weight of 157.07 g/mol. Its IUPAC name is carbamic acid;diaminophosphinic acid.
Molecular Properties
| Compound Name | carbamic acid;diaminophosphinic acid |
| PubChem CID | 158832791 |
| Molecular Formula | CH8N3O4P |
| Molecular Weight | 157.07 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | carbamic acid;diaminophosphinic acid |
| SMILES | NC(=O)O.NP(N)(=O)O |
| InChI | InChI=1S/CH3NO2.H5N2O2P/c2-1(3)4;1-5(2,3)4/h2H2,(H,3,4);(H5,1,2,3,4) |
| InChIKey | IXGJORZQCSUHBH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.07 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;diaminophosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;diaminophosphinic acid?
The IUPAC name of carbamic acid;diaminophosphinic acid (CID 158832791) is carbamic acid;diaminophosphinic acid.
What is the SMILES notation for carbamic acid;diaminophosphinic acid?
The canonical SMILES for carbamic acid;diaminophosphinic acid is NC(=O)O.NP(N)(=O)O.
What is the InChIKey of carbamic acid;diaminophosphinic acid?
The InChIKey is IXGJORZQCSUHBH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO2.H5N2O2P/c2-1(3)4;1-5(2,3)4/h2H2,(H,3,4);(H5,1,2,3,4).
What are the key properties of carbamic acid;diaminophosphinic acid?
carbamic acid;diaminophosphinic acid has a molecular weight of 157.07 g/mol, XLogP of -1.37, 0 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;diaminophosphinic acid is sourced from PubChem (CID 158832791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).