C38H78N4 — CID 158834320
1,4-ditert-butyl-3,6-dihydro-2H-pyridine;1,4-ditert-butylpiperazine;1,4-ditert-butylpiperidine (PubChem CID 158834320) has the molecular formula C38H78N4 and a molecular weight of 591.07 g/mol. Its IUPAC name is 1,4-ditert-butyl-3,6-dihydro-2H-pyridine;1,4-ditert-butylpiperazine;1,4-ditert-butylpiperidine.
| Compound Name | 1,4-ditert-butyl-3,6-dihydro-2H-pyridine;1,4-ditert-butylpiperazine;1,4-ditert-butylpiperidine |
|---|---|
| PubChem CID | 158834320 |
| Molecular Formula | C38H78N4 |
| Molecular Weight | 591.07 g/mol |
| Exact Mass | 590.62 |
| IUPAC Name | 1,4-ditert-butyl-3,6-dihydro-2H-pyridine;1,4-ditert-butylpiperazine;1,4-ditert-butylpiperidine |
| SMILES | CC(C)(C)C1=CCN(C(C)(C)C)CC1.CC(C)(C)C1CCN(C(C)(C)C)CC1.CC(C)(C)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N.C13H25N.C12H26N2/c2*1-12(2,3)11-7-9-14(10-8-11)13(4,5)6;1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h11H,7-10H2,1-6H3;7H,8-10H2,1-6H3;7-10H2,1-6H3 |
| InChIKey | IXLBJVOYWFHTAC-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.07 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|