C16H13N4+ — CID 158837910
11-(trideuteriomethyl)-1,4,14-triaza-11-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2,5,7,9,11,13(18),14,16-octaene (PubChem CID 158837910) has the molecular formula C16H13N4+ and a molecular weight of 264.33 g/mol. Its IUPAC name is 11-(trideuteriomethyl)-1,4,14-triaza-11-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2,5,7,9,11,13(18),14,16-octaene.
| Compound Name | 11-(trideuteriomethyl)-1,4,14-triaza-11-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2,5,7,9,11,13(18),14,16-octaene |
|---|---|
| PubChem CID | 158837910 |
| Molecular Formula | C16H13N4+ |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 11-(trideuteriomethyl)-1,4,14-triaza-11-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2,5,7,9,11,13(18),14,16-octaene |
| SMILES | [2H]C([2H])([2H])[n+]1c2n(c3cn4ccccc4c31)Cc1cccnc1-2 |
| InChI | InChI=1S/C16H13N4/c1-18-15-12-6-2-3-8-19(12)10-13(15)20-9-11-5-4-7-17-14(11)16(18)20/h2-8,10H,9H2,1H3/q+1/i1D3 |
| InChIKey | MIQIPURZRXMETG-FIBGUPNXSA-N |
| XLogP | 2.14 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|