C17H23ClN2O3 — CID 158840831
methyl 1-[5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]cyclopropane-1-carboxylate (PubChem CID 158840831) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is methyl 1-[5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 158840831 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | methyl 1-[5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(Oc2cc(Cl)ccc2CN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-19-7-9-20(10-8-19)12-13-3-4-14(18)11-15(13)23-17(5-6-17)16(21)22-2/h3-4,11H,5-10,12H2,1-2H3 |
| InChIKey | CNIHDTUMEFWBLM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |