C21H42N6 — CID 158842263
bis(1,4-ditert-butyltriazole);methane (PubChem CID 158842263) has the molecular formula C21H42N6 and a molecular weight of 378.61 g/mol. Its IUPAC name is bis(1,4-ditert-butyltriazole);methane.
| Compound Name | bis(1,4-ditert-butyltriazole);methane |
|---|---|
| PubChem CID | 158842263 |
| Molecular Formula | C21H42N6 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.35 |
| IUPAC Name | bis(1,4-ditert-butyltriazole);methane |
| SMILES | C.CC(C)(C)c1cn(C(C)(C)C)nn1.CC(C)(C)c1cn(C(C)(C)C)nn1 |
| InChI | InChI=1S/2C10H19N3.CH4/c2*1-9(2,3)8-7-13(12-11-8)10(4,5)6;/h2*7H,1-6H3;1H4 |
| InChIKey | IYJULPPVQJGGSG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |