C38H56N2O — CID 158842598
bicyclo[2.2.1]heptan-2-one;2,6-di(propan-2-yl)aniline;N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine (PubChem CID 158842598) has the molecular formula C38H56N2O and a molecular weight of 556.88 g/mol. Its IUPAC name is bicyclo[2.2.1]heptan-2-one;2,6-di(propan-2-yl)aniline;N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine.
| Compound Name | bicyclo[2.2.1]heptan-2-one;2,6-di(propan-2-yl)aniline;N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 158842598 |
| Molecular Formula | C38H56N2O |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.44 |
| IUPAC Name | bicyclo[2.2.1]heptan-2-one;2,6-di(propan-2-yl)aniline;N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1/CC2CCC1C2.CC(C)c1cccc(C(C)C)c1N.O=C1CC2CCC1C2 |
| InChI | InChI=1S/C19H27N.C12H19N.C7H10O/c1-12(2)16-6-5-7-17(13(3)4)19(16)20-18-11-14-8-9-15(18)10-14;1-8(2)10-6-5-7-11(9(3)4)12(10)13;8-7-4-5-1-2-6(7)3-5/h5-7,12-15H,8-11H2,1-4H3;5-9H,13H2,1-4H3;5-6H,1-4H2/b20-18-;; |
| InChIKey | IYKXOOFPVSKMMM-DJOSVPKASA-N |
| XLogP | 10.72 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|