C38H62N4O9 — CID 158860158
4-butoxy-3,5-dimethoxybenzoic acid;(4-butoxy-3,5-dimethoxyphenyl)-(4-ethylpiperazin-1-yl)methanone;1-ethylpiperazine (PubChem CID 158860158) has the molecular formula C38H62N4O9 and a molecular weight of 718.93 g/mol. Its IUPAC name is 4-butoxy-3,5-dimethoxybenzoic acid;(4-butoxy-3,5-dimethoxyphenyl)-(4-ethylpiperazin-1-yl)methanone;1-ethylpiperazine.
| Compound Name | 4-butoxy-3,5-dimethoxybenzoic acid;(4-butoxy-3,5-dimethoxyphenyl)-(4-ethylpiperazin-1-yl)methanone;1-ethylpiperazine |
|---|---|
| PubChem CID | 158860158 |
| Molecular Formula | C38H62N4O9 |
| Molecular Weight | 718.93 g/mol |
| Exact Mass | 718.45 |
| IUPAC Name | 4-butoxy-3,5-dimethoxybenzoic acid;(4-butoxy-3,5-dimethoxyphenyl)-(4-ethylpiperazin-1-yl)methanone;1-ethylpiperazine |
| SMILES | CCCCOc1c(OC)cc(C(=O)N2CCN(CC)CC2)cc1OC.CCCCOc1c(OC)cc(C(=O)O)cc1OC.CCN1CCNCC1 |
| InChI | InChI=1S/C19H30N2O4.C13H18O5.C6H14N2/c1-5-7-12-25-18-16(23-3)13-15(14-17(18)24-4)19(22)21-10-8-20(6-2)9-11-21;1-4-5-6-18-12-10(16-2)7-9(13(14)15)8-11(12)17-3;1-2-8-5-3-7-4-6-8/h13-14H,5-12H2,1-4H3;7-8H,4-6H2,1-3H3,(H,14,15);7H,2-6H2,1H3 |
| InChIKey | JAOAQJINWCKQDK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.93 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|