C29H26F5N7O6S — CID 158878600
1-(2-fluoroethyl)-N-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;methyl 4-(2-fluoroethylamino)-3-nitrobenzoate (PubChem CID 158878600) has the molecular formula C29H26F5N7O6S and a molecular weight of 695.63 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;methyl 4-(2-fluoroethylamino)-3-nitrobenzoate.
| Compound Name | 1-(2-fluoroethyl)-N-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;methyl 4-(2-fluoroethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 158878600 |
| Molecular Formula | C29H26F5N7O6S |
| Molecular Weight | 695.63 g/mol |
| Exact Mass | 695.16 |
| IUPAC Name | 1-(2-fluoroethyl)-N-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;methyl 4-(2-fluoroethylamino)-3-nitrobenzoate |
| SMILES | CNC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2CCF.COC(=O)c1ccc(NCCF)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15F4N5O2S.C10H11FN2O4/c1-24-16(29)10-2-5-14-13(8-10)25-17(28(14)7-6-20)27-18-26-12-4-3-11(9-15(12)31-18)30-19(21,22)23;1-17-10(14)7-2-3-8(12-5-4-11)9(6-7)13(15)16/h2-5,8-9H,6-7H2,1H3,(H,24,29)(H,25,26,27);2-3,6,12H,4-5H2,1H3 |
| InChIKey | JCTFBQXAVKHULO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|