C32H46ClF10P — CID 158882821
bis(1-ethyl-2,3,4,5,6-pentafluorobenzene);tetrabutyl(chloro)-λ5-phosphane (PubChem CID 158882821) has the molecular formula C32H46ClF10P and a molecular weight of 687.13 g/mol. Its IUPAC name is bis(1-ethyl-2,3,4,5,6-pentafluorobenzene);tetrabutyl(chloro)-λ5-phosphane.
| Compound Name | bis(1-ethyl-2,3,4,5,6-pentafluorobenzene);tetrabutyl(chloro)-λ5-phosphane |
|---|---|
| PubChem CID | 158882821 |
| Molecular Formula | C32H46ClF10P |
| Molecular Weight | 687.13 g/mol |
| Exact Mass | 686.29 |
| IUPAC Name | bis(1-ethyl-2,3,4,5,6-pentafluorobenzene);tetrabutyl(chloro)-λ5-phosphane |
| SMILES | CCCCP(Cl)(CCCC)(CCCC)CCCC.CCc1c(F)c(F)c(F)c(F)c1F.CCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H36ClP.2C8H5F5/c1-5-9-13-18(17,14-10-6-2,15-11-7-3)16-12-8-4;2*1-2-3-4(9)6(11)8(13)7(12)5(3)10/h5-16H2,1-4H3;2*2H2,1H3 |
| InChIKey | JDFXWCMAJSDUJF-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.13 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|