C33H45F3N8O6 — CID 158889283
1-[(4-acetylcyclohexyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]methyl]purine-2,6-dione (PubChem CID 158889283) has the molecular formula C33H45F3N8O6 and a molecular weight of 706.77 g/mol. Its IUPAC name is 1-[(4-acetylcyclohexyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]methyl]purine-2,6-dione.
| Compound Name | 1-[(4-acetylcyclohexyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 158889283 |
| Molecular Formula | C33H45F3N8O6 |
| Molecular Weight | 706.77 g/mol |
| Exact Mass | 706.34 |
| IUPAC Name | 1-[(4-acetylcyclohexyl)methyl]-3,7-dimethylpurine-2,6-dione;3,7-dimethyl-1-[[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]methyl]purine-2,6-dione |
| SMILES | CC(=O)C1CCC(Cn2c(=O)c3c(ncn3C)n(C)c2=O)CC1.Cn1cnc2c1c(=O)n(CC1CCC(C(C)(O)C(F)(F)F)CC1)c(=O)n2C |
| InChI | InChI=1S/C17H23F3N4O3.C16H22N4O3/c1-16(27,17(18,19)20)11-6-4-10(5-7-11)8-24-14(25)12-13(21-9-22(12)2)23(3)15(24)26;1-10(21)12-6-4-11(5-7-12)8-20-15(22)13-14(17-9-18(13)2)19(3)16(20)23/h9-11,27H,4-8H2,1-3H3;9,11-12H,4-8H2,1-3H3 |
| InChIKey | JEADSTBQEHCTRW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |