C29H35F9N8O6 — CID 145301431
1-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclobutyl]methyl]-3,7-dimethylpurine-2,6-dione;1-(trifluoromethyl)cyclopentan-1-ol;1,3,7-trimethylpurine-2,6-dione (PubChem CID 145301431) has the molecular formula C29H35F9N8O6 and a molecular weight of 762.63 g/mol. Its IUPAC name is 1-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclobutyl]methyl]-3,7-dimethylpurine-2,6-dione;1-(trifluoromethyl)cyclopentan-1-ol;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 1-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclobutyl]methyl]-3,7-dimethylpurine-2,6-dione;1-(trifluoromethyl)cyclopentan-1-ol;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 145301431 |
| Molecular Formula | C29H35F9N8O6 |
| Molecular Weight | 762.63 g/mol |
| Exact Mass | 762.25 |
| IUPAC Name | 1-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclobutyl]methyl]-3,7-dimethylpurine-2,6-dione;1-(trifluoromethyl)cyclopentan-1-ol;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.Cn1cnc2c1c(=O)n(CC1CC(C(O)(C(F)(F)F)C(F)(F)F)C1)c(=O)n2C.OC1(C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C15H16F6N4O3.C8H10N4O2.C6H9F3O/c1-23-6-22-10-9(23)11(26)25(12(27)24(10)2)5-7-3-8(4-7)13(28,14(16,17)18)15(19,20)21;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;7-6(8,9)5(10)3-1-2-4-5/h6-8,28H,3-5H2,1-2H3;4H,1-3H3;10H,1-4H2 |
| InChIKey | CATNGBQGFLCZMV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 164.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |