C14H13F3N4O3 — CID 130333203
3-ethynyl-1-[[3-hydroxy-3-(trifluoromethyl)cyclobutyl]methyl]-7-methylpurine-2,6-dione (PubChem CID 130333203) has the molecular formula C14H13F3N4O3 and a molecular weight of 342.28 g/mol. Its IUPAC name is 3-ethynyl-1-[[3-hydroxy-3-(trifluoromethyl)cyclobutyl]methyl]-7-methylpurine-2,6-dione.
| Compound Name | 3-ethynyl-1-[[3-hydroxy-3-(trifluoromethyl)cyclobutyl]methyl]-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 130333203 |
| Molecular Formula | C14H13F3N4O3 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-ethynyl-1-[[3-hydroxy-3-(trifluoromethyl)cyclobutyl]methyl]-7-methylpurine-2,6-dione |
| SMILES | C#Cn1c(=O)n(CC2CC(O)(C(F)(F)F)C2)c(=O)c2c1ncn2C |
| InChI | InChI=1S/C14H13F3N4O3/c1-3-20-10-9(19(2)7-18-10)11(22)21(12(20)23)6-8-4-13(24,5-8)14(15,16)17/h1,7-8,24H,4-6H2,2H3 |
| InChIKey | CPWPLHGSMMXWNE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|