C17H24N4O4 — CID 54563322
1-[[3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]methyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 54563322) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[[3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]methyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[[3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]methyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 54563322 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[[3-[2-(3,3-dimethyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]methyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CC1OC1(C)CCC1OC1(C)C)c(=O)n2C |
| InChI | InChI=1S/C17H24N4O4/c1-16(2)10(24-16)6-7-17(3)11(25-17)8-21-14(22)12-13(18-9-19(12)4)20(5)15(21)23/h9-11H,6-8H2,1-5H3 |
| InChIKey | ZSCBCSNXMCMKKK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|