C29H29N3O4 — CID 158891815
2-[(1S,2R,3S,5S)-3-amino-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione;2-[(1S,2S,3S,5S)-3-methyl-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione (PubChem CID 158891815) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[(1S,2R,3S,5S)-3-amino-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione;2-[(1S,2S,3S,5S)-3-methyl-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,2R,3S,5S)-3-amino-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione;2-[(1S,2S,3S,5S)-3-methyl-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158891815 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-[(1S,2R,3S,5S)-3-amino-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione;2-[(1S,2S,3S,5S)-3-methyl-2-bicyclo[3.1.0]hexanyl]isoindole-1,3-dione |
| SMILES | C[C@H]1C[C@@H]2C[C@@H]2[C@H]1N1C(=O)c2ccccc2C1=O.N[C@H]1C[C@@H]2C[C@@H]2[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO2.C14H14N2O2/c1-8-6-9-7-12(9)13(8)16-14(17)10-4-2-3-5-11(10)15(16)18;15-11-6-7-5-10(7)12(11)16-13(17)8-3-1-2-4-9(8)14(16)18/h2-5,8-9,12-13H,6-7H2,1H3;1-4,7,10-12H,5-6,15H2/t8-,9+,12-,13-;7-,10-,11-,12+/m00/s1 |
| InChIKey | JEIHCWHTFLRFAB-PWOIXPBTSA-N |
| XLogP | 3.35 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|