C16H17NO6 — CID 11186237
2-[(1S,2S,7R)-3,4,5,6-tetrahydroxy-2-bicyclo[5.1.0]octanyl]isoindole-1,3-dione (PubChem CID 11186237) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[(1S,2S,7R)-3,4,5,6-tetrahydroxy-2-bicyclo[5.1.0]octanyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,2S,7R)-3,4,5,6-tetrahydroxy-2-bicyclo[5.1.0]octanyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11186237 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[(1S,2S,7R)-3,4,5,6-tetrahydroxy-2-bicyclo[5.1.0]octanyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1C(O)C(O)C(O)C(O)[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C16H17NO6/c18-11-9-5-8(9)10(12(19)14(21)13(11)20)17-15(22)6-3-1-2-4-7(6)16(17)23/h1-4,8-14,18-21H,5H2/t8-,9+,10-,11?,12?,13?,14?/m0/s1 |
| InChIKey | XDARHXHATPCMAW-YABROOFESA-N |
| XLogP | -1.26 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|