C27H23BBrF — CID 158899890
1-bromo-9,9-dimethylfluorene;fluoro(diphenyl)borane (PubChem CID 158899890) has the molecular formula C27H23BBrF and a molecular weight of 457.20 g/mol. Its IUPAC name is 1-bromo-9,9-dimethylfluorene;fluoro(diphenyl)borane.
| Compound Name | 1-bromo-9,9-dimethylfluorene;fluoro(diphenyl)borane |
|---|---|
| PubChem CID | 158899890 |
| Molecular Formula | C27H23BBrF |
| Molecular Weight | 457.20 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-bromo-9,9-dimethylfluorene;fluoro(diphenyl)borane |
| SMILES | CC1(C)c2ccccc2-c2cccc(Br)c21.FB(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13Br.C12H10BF/c1-15(2)12-8-4-3-6-10(12)11-7-5-9-13(16)14(11)15;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h3-9H,1-2H3;1-10H |
| InChIKey | JFHLBSGJJOKCHH-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.20 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|