C14H12BrN — CID 139525003
8-bromo-9,9-dimethylindeno[2,1-c]pyridine (PubChem CID 139525003) has the molecular formula C14H12BrN and a molecular weight of 274.16 g/mol. Its IUPAC name is 8-bromo-9,9-dimethylindeno[2,1-c]pyridine.
| Compound Name | 8-bromo-9,9-dimethylindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 139525003 |
| Molecular Formula | C14H12BrN |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 8-bromo-9,9-dimethylindeno[2,1-c]pyridine |
| SMILES | CC1(C)c2cnccc2-c2cccc(Br)c21 |
| InChI | InChI=1S/C14H12BrN/c1-14(2)11-8-16-7-6-9(11)10-4-3-5-12(15)13(10)14/h3-8H,1-2H3 |
| InChIKey | BXXVZURYHDVREG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |