About lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate
lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate (PubChem CID 101389050) has the molecular formula C14H12LiNO2
and a molecular weight of 233.20 g/mol. Its IUPAC name is lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate.
Molecular Properties
| Compound Name | lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate |
| PubChem CID | 101389050 |
| Molecular Formula | C14H12LiNO2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate |
| SMILES | CCOC1([O-])c2ccccc2-c2ccncc21.[Li+] |
| InChI | InChI=1S/C14H12NO2.Li/c1-2-17-14(16)12-6-4-3-5-10(12)11-7-8-15-9-13(11)14;/h3-9H,2H2,1H3;/q-1;+1 |
| InChIKey | TZMSTYTXILPVIR-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 45.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate?
The IUPAC name of lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate (CID 101389050) is lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate.
What is the SMILES notation for lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate?
The canonical SMILES for lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate is CCOC1([O-])c2ccccc2-c2ccncc21.[Li+].
What is the InChIKey of lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate?
The InChIKey is TZMSTYTXILPVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12NO2.Li/c1-2-17-14(16)12-6-4-3-5-10(12)11-7-8-15-9-13(11)14;/h3-9H,2H2,1H3;/q-1;+1.
What are the key properties of lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate?
lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate has a molecular weight of 233.20 g/mol, XLogP of -1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate is sourced from PubChem (CID 101389050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).