C14H12LiNO2 — CID 101389050
lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate (PubChem CID 101389050) has the molecular formula C14H12LiNO2 and a molecular weight of 233.20 g/mol. Its IUPAC name is lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate.
| Compound Name | lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate |
|---|---|
| PubChem CID | 101389050 |
| Molecular Formula | C14H12LiNO2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | lithium 9-ethoxyindeno[2,1-c]pyridin-9-olate |
| SMILES | CCOC1([O-])c2ccccc2-c2ccncc21.[Li+] |
| InChI | InChI=1S/C14H12NO2.Li/c1-2-17-14(16)12-6-4-3-5-10(12)11-7-8-15-9-13(11)14;/h3-9H,2H2,1H3;/q-1;+1 |
| InChIKey | TZMSTYTXILPVIR-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 45.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|