About indeno[3,2-c]pyridine-5,5-diol
indeno[3,2-c]pyridine-5,5-diol (PubChem CID 101389053) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is indeno[3,2-c]pyridine-5,5-diol.
Molecular Properties
| Compound Name | indeno[3,2-c]pyridine-5,5-diol |
| PubChem CID | 101389053 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | indeno[3,2-c]pyridine-5,5-diol |
| SMILES | OC1(O)c2ccccc2-c2cnccc21 |
| InChI | InChI=1S/C12H9NO2/c14-12(15)10-4-2-1-3-8(10)9-7-13-6-5-11(9)12/h1-7,14-15H |
| InChIKey | ATAZPFFVPMWDBC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze indeno[3,2-c]pyridine-5,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[3,2-c]pyridine-5,5-diol?
The IUPAC name of indeno[3,2-c]pyridine-5,5-diol (CID 101389053) is indeno[3,2-c]pyridine-5,5-diol.
What is the SMILES notation for indeno[3,2-c]pyridine-5,5-diol?
The canonical SMILES for indeno[3,2-c]pyridine-5,5-diol is OC1(O)c2ccccc2-c2cnccc21.
What is the InChIKey of indeno[3,2-c]pyridine-5,5-diol?
The InChIKey is ATAZPFFVPMWDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c14-12(15)10-4-2-1-3-8(10)9-7-13-6-5-11(9)12/h1-7,14-15H.
What are the key properties of indeno[3,2-c]pyridine-5,5-diol?
indeno[3,2-c]pyridine-5,5-diol has a molecular weight of 199.21 g/mol, XLogP of 1.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[3,2-c]pyridine-5,5-diol is sourced from PubChem (CID 101389053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).