C12H9NO2 — CID 101389053
indeno[3,2-c]pyridine-5,5-diol (PubChem CID 101389053) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is indeno[3,2-c]pyridine-5,5-diol.
| Compound Name | indeno[3,2-c]pyridine-5,5-diol |
|---|---|
| PubChem CID | 101389053 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | indeno[3,2-c]pyridine-5,5-diol |
| SMILES | OC1(O)c2ccccc2-c2cnccc21 |
| InChI | InChI=1S/C12H9NO2/c14-12(15)10-4-2-1-3-8(10)9-7-13-6-5-11(9)12/h1-7,14-15H |
| InChIKey | ATAZPFFVPMWDBC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|