C39H32BrN3 — CID 163806857
2-[4-(5-bromo-9,9,10,10-tetramethylanthracen-1-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 163806857) has the molecular formula C39H32BrN3 and a molecular weight of 622.61 g/mol. Its IUPAC name is 2-[4-(5-bromo-9,9,10,10-tetramethylanthracen-1-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-(5-bromo-9,9,10,10-tetramethylanthracen-1-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163806857 |
| Molecular Formula | C39H32BrN3 |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | 2-[4-(5-bromo-9,9,10,10-tetramethylanthracen-1-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c2C(C)(C)c2cccc(Br)c21 |
| InChI | InChI=1S/C39H32BrN3/c1-38(2)31-19-12-20-32(40)34(31)39(3,4)30-18-11-17-29(33(30)38)25-21-23-28(24-22-25)37-42-35(26-13-7-5-8-14-26)41-36(43-37)27-15-9-6-10-16-27/h5-24H,1-4H3 |
| InChIKey | NJTBCOFSJJQDMQ-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |