C28H44N8O4S2 — CID 158910770
tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-isothiocyanatopiperidine-1-carboxylate;di(imidazol-1-yl)methanethione (PubChem CID 158910770) has the molecular formula C28H44N8O4S2 and a molecular weight of 620.85 g/mol. Its IUPAC name is tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-isothiocyanatopiperidine-1-carboxylate;di(imidazol-1-yl)methanethione.
| Compound Name | tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-isothiocyanatopiperidine-1-carboxylate;di(imidazol-1-yl)methanethione |
|---|---|
| PubChem CID | 158910770 |
| Molecular Formula | C28H44N8O4S2 |
| Molecular Weight | 620.85 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | tert-butyl 4-aminopiperidine-1-carboxylate;tert-butyl 4-isothiocyanatopiperidine-1-carboxylate;di(imidazol-1-yl)methanethione |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1.CC(C)(C)OC(=O)N1CCC(N=C=S)CC1.S=C(n1ccnc1)n1ccnc1 |
| InChI | InChI=1S/C11H18N2O2S.C10H20N2O2.C7H6N4S/c1-11(2,3)15-10(14)13-6-4-9(5-7-13)12-8-16;1-10(2,3)14-9(13)12-6-4-8(11)5-7-12;12-7(10-3-1-8-5-10)11-4-2-9-6-11/h9H,4-7H2,1-3H3;8H,4-7,11H2,1-3H3;1-6H |
| InChIKey | JGPQJPUEMXDDDW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|